C16H12N2 — CID 158278973
N-(3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-yl)methanimine (PubChem CID 158278973) has the molecular formula C16H12N2 and a molecular weight of 232.29 g/mol. Its IUPAC name is N-(3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-yl)methanimine.
| Compound Name | N-(3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-yl)methanimine |
|---|---|
| PubChem CID | 158278973 |
| Molecular Formula | C16H12N2 |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-(3,10-dihydro-1H-indeno[2,1-e]isoindol-2-ium-3-id-2-yl)methanimine |
| SMILES | C=N[N+]1=[C-]c2ccc3c(c2C1)Cc1ccccc1-3 |
| InChI | InChI=1S/C16H12N2/c1-17-18-9-12-6-7-14-13-5-3-2-4-11(13)8-15(14)16(12)10-18/h2-7H,1,8,10H2 |
| InChIKey | HRMHRSAIOAIFPA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|