C13H10O6S2 — CID 22770255
9H-fluorene-1,2-disulfonic acid (PubChem CID 22770255) has the molecular formula C13H10O6S2 and a molecular weight of 326.35 g/mol. Its IUPAC name is 9H-fluorene-1,2-disulfonic acid.
| Compound Name | 9H-fluorene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 22770255 |
| Molecular Formula | C13H10O6S2 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 325.99 |
| IUPAC Name | 9H-fluorene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1S(=O)(=O)O)Cc1ccccc1-2 |
| InChI | InChI=1S/C13H10O6S2/c14-20(15,16)12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)21(17,18)19/h1-6H,7H2,(H,14,15,16)(H,17,18,19) |
| InChIKey | SIAKPUUEJVOXBR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|