C13H11NO3S — CID 163637322
9,10-dihydroacridine-1-sulfonic acid (PubChem CID 163637322) has the molecular formula C13H11NO3S and a molecular weight of 261.30 g/mol. Its IUPAC name is 9,10-dihydroacridine-1-sulfonic acid.
| Compound Name | 9,10-dihydroacridine-1-sulfonic acid |
|---|---|
| PubChem CID | 163637322 |
| Molecular Formula | C13H11NO3S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 9,10-dihydroacridine-1-sulfonic acid |
| SMILES | O=S(=O)(O)c1cccc2c1Cc1ccccc1N2 |
| InChI | InChI=1S/C13H11NO3S/c15-18(16,17)13-7-3-6-12-10(13)8-9-4-1-2-5-11(9)14-12/h1-7,14H,8H2,(H,15,16,17) |
| InChIKey | IBHHJBHGWXGMDO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|