C28H38F6NO4S2+ — CID 162080939
1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;ethyl-dimethyl-nonylazanium (PubChem CID 162080939) has the molecular formula C28H38F6NO4S2+ and a molecular weight of 630.74 g/mol. Its IUPAC name is 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;ethyl-dimethyl-nonylazanium.
| Compound Name | 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;ethyl-dimethyl-nonylazanium |
|---|---|
| PubChem CID | 162080939 |
| Molecular Formula | C28H38F6NO4S2+ |
| Molecular Weight | 630.74 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | 1,2-bis(trifluoromethylsulfonyl)-9H-fluorene;ethyl-dimethyl-nonylazanium |
| SMILES | CCCCCCCCC[N+](C)(C)CC.O=S(=O)(c1ccc2c(c1S(=O)(=O)C(F)(F)F)Cc1ccccc1-2)C(F)(F)F |
| InChI | InChI=1S/C15H8F6O4S2.C13H30N/c16-14(17,18)26(22,23)12-6-5-10-9-4-2-1-3-8(9)7-11(10)13(12)27(24,25)15(19,20)21;1-5-7-8-9-10-11-12-13-14(3,4)6-2/h1-6H,7H2;5-13H2,1-4H3/q;+1 |
| InChIKey | ZCIGNUPWACTAPR-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.74 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|