C15H18O4 — CID 160668693
2-[(3S)-3-benzyl-1-hydroxycyclopentyl]acetaldehyde;carbon dioxide (PubChem CID 160668693) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(3S)-3-benzyl-1-hydroxycyclopentyl]acetaldehyde;carbon dioxide.
| Compound Name | 2-[(3S)-3-benzyl-1-hydroxycyclopentyl]acetaldehyde;carbon dioxide |
|---|---|
| PubChem CID | 160668693 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2-[(3S)-3-benzyl-1-hydroxycyclopentyl]acetaldehyde;carbon dioxide |
| SMILES | O=C=O.O=CCC1(O)CC[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H18O2.CO2/c15-9-8-14(16)7-6-13(11-14)10-12-4-2-1-3-5-12;2-1-3/h1-5,9,13,16H,6-8,10-11H2;/t13-,14?;/m0./s1 |
| InChIKey | RMQKWEFSNDVAQL-GPFYXIAXSA-N |
| XLogP | 1.77 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|