C19H27N3O2 — CID 143476680
(E)-3-amino-N-[2-(4-benzyl-1-hydroxycyclohexyl)ethyl]-2-methanimidoylprop-2-enamide (PubChem CID 143476680) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is (E)-3-amino-N-[2-(4-benzyl-1-hydroxycyclohexyl)ethyl]-2-methanimidoylprop-2-enamide.
| Compound Name | (E)-3-amino-N-[2-(4-benzyl-1-hydroxycyclohexyl)ethyl]-2-methanimidoylprop-2-enamide |
|---|---|
| PubChem CID | 143476680 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | (E)-3-amino-N-[2-(4-benzyl-1-hydroxycyclohexyl)ethyl]-2-methanimidoylprop-2-enamide |
| SMILES | [H]/N=C/C(=C\N)C(=O)NCCC1(O)CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O2/c20-13-17(14-21)18(23)22-11-10-19(24)8-6-16(7-9-19)12-15-4-2-1-3-5-15/h1-5,13-14,16,20,24H,6-12,21H2,(H,22,23)/b17-14+,20-13+ |
| InChIKey | UWGGMXGDQRIIMG-WHJGSLCXSA-N |
| XLogP | 2.15 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|