C24H40N4O5 — CID 160672089
tert-butyl N-[6-[[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]amino]-6-oxohexyl]carbamate;methane (PubChem CID 160672089) has the molecular formula C24H40N4O5 and a molecular weight of 464.61 g/mol. Its IUPAC name is tert-butyl N-[6-[[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]amino]-6-oxohexyl]carbamate;methane.
| Compound Name | tert-butyl N-[6-[[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]amino]-6-oxohexyl]carbamate;methane |
|---|---|
| PubChem CID | 160672089 |
| Molecular Formula | C24H40N4O5 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | tert-butyl N-[6-[[(1S,2R)-1-hydroxy-3-oxo-1-pyridin-4-yl-3-pyrrolidin-1-ylpropan-2-yl]amino]-6-oxohexyl]carbamate;methane |
| SMILES | C.CC(C)(C)OC(=O)NCCCCCC(=O)N[C@@H](C(=O)N1CCCC1)[C@@H](O)c1ccncc1 |
| InChI | InChI=1S/C23H36N4O5.CH4/c1-23(2,3)32-22(31)25-12-6-4-5-9-18(28)26-19(21(30)27-15-7-8-16-27)20(29)17-10-13-24-14-11-17;/h10-11,13-14,19-20,29H,4-9,12,15-16H2,1-3H3,(H,25,31)(H,26,28);1H4/t19-,20+;/m1./s1 |
| InChIKey | RNBAAHCXOONGHG-FDOHDBATSA-N |
| XLogP | 2.94 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|