C42H54B3ClO8 — CID 160673019
4-chloro-2-phenylphenol;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 160673019) has the molecular formula C42H54B3ClO8 and a molecular weight of 754.78 g/mol. Its IUPAC name is 4-chloro-2-phenylphenol;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4-chloro-2-phenylphenol;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 160673019 |
| Molecular Formula | C42H54B3ClO8 |
| Molecular Weight | 754.78 g/mol |
| Exact Mass | 754.38 |
| IUPAC Name | 4-chloro-2-phenylphenol;2-phenyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.CC1(C)OB(c2ccc(O)c(-c3ccccc3)c2)OC1(C)C.Oc1ccc(Cl)cc1-c1ccccc1 |
| InChI | InChI=1S/C18H21BO3.C12H24B2O4.C12H9ClO/c1-17(2)18(3,4)22-19(21-17)14-10-11-16(20)15(12-14)13-8-6-5-7-9-13;1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h5-12,20H,1-4H3;1-8H3;1-8,14H |
| InChIKey | RNEGFKMZYQRXFB-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.78 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|