C37H46F2N2O11 — CID 160676070
bis[3-fluoro-4-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]methanone;oxalic acid (PubChem CID 160676070) has the molecular formula C37H46F2N2O11 and a molecular weight of 732.77 g/mol. Its IUPAC name is bis[3-fluoro-4-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]methanone;oxalic acid.
| Compound Name | bis[3-fluoro-4-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]methanone;oxalic acid |
|---|---|
| PubChem CID | 160676070 |
| Molecular Formula | C37H46F2N2O11 |
| Molecular Weight | 732.77 g/mol |
| Exact Mass | 732.31 |
| IUPAC Name | bis[3-fluoro-4-[(1R,2R)-2-pyrrolidin-1-ylcyclohexyl]oxyphenyl]methanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(O)C(=O)O.O=C(c1ccc(O[C@@H]2CCCC[C@H]2N2CCCC2)c(F)c1)c1ccc(O[C@@H]2CCCC[C@H]2N2CCCC2)c(F)c1 |
| InChI | InChI=1S/C33H42F2N2O3.2C2H2O4/c34-25-21-23(13-15-29(25)39-31-11-3-1-9-27(31)36-17-5-6-18-36)33(38)24-14-16-30(26(35)22-24)40-32-12-4-2-10-28(32)37-19-7-8-20-37;2*3-1(4)2(5)6/h13-16,21-22,27-28,31-32H,1-12,17-20H2;2*(H,3,4)(H,5,6)/t27-,28-,31-,32-;;/m1../s1 |
| InChIKey | RNNUVWFYFUVXKM-ZQAFRQJQSA-N |
| XLogP | 5.08 |
| TPSA | 191.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.77 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|