C19H28N2O5S — CID 160676209
5-[(7-tert-butyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-1H-imidazole;sulfuric acid (PubChem CID 160676209) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-[(7-tert-butyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-1H-imidazole;sulfuric acid.
| Compound Name | 5-[(7-tert-butyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-1H-imidazole;sulfuric acid |
|---|---|
| PubChem CID | 160676209 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 5-[(7-tert-butyl-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-1H-imidazole;sulfuric acid |
| SMILES | COc1cc2c(cc1C(C)(C)C)C(Cc1cnc[nH]1)CCC2.O=S(=O)(O)O |
| InChI | InChI=1S/C19H26N2O.H2O4S/c1-19(2,3)17-10-16-13(8-15-11-20-12-21-15)6-5-7-14(16)9-18(17)22-4;1-5(2,3)4/h9-13H,5-8H2,1-4H3,(H,20,21);(H2,1,2,3,4) |
| InChIKey | RNOHYDATBVNCHZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|