C15H16Cl4N2O2Sn — CID 160803449
1-(1H-imidazol-5-ylmethyl)-6-methoxy-2,3-dihydro-1H-indene-5-carbaldehyde;tetrachlorostannane (PubChem CID 160803449) has the molecular formula C15H16Cl4N2O2Sn and a molecular weight of 516.83 g/mol. Its IUPAC name is 1-(1H-imidazol-5-ylmethyl)-6-methoxy-2,3-dihydro-1H-indene-5-carbaldehyde;tetrachlorostannane.
| Compound Name | 1-(1H-imidazol-5-ylmethyl)-6-methoxy-2,3-dihydro-1H-indene-5-carbaldehyde;tetrachlorostannane |
|---|---|
| PubChem CID | 160803449 |
| Molecular Formula | C15H16Cl4N2O2Sn |
| Molecular Weight | 516.83 g/mol |
| Exact Mass | 515.90 |
| IUPAC Name | 1-(1H-imidazol-5-ylmethyl)-6-methoxy-2,3-dihydro-1H-indene-5-carbaldehyde;tetrachlorostannane |
| SMILES | COc1cc2c(cc1C=O)CCC2Cc1cnc[nH]1.Cl[Sn](Cl)(Cl)Cl |
| InChI | InChI=1S/C15H16N2O2.4ClH.Sn/c1-19-15-6-14-10(4-12(15)8-18)2-3-11(14)5-13-7-16-9-17-13;;;;;/h4,6-9,11H,2-3,5H2,1H3,(H,16,17);4*1H;/q;;;;;+4/p-4 |
| InChIKey | SDJPHNFPDNVVHN-UHFFFAOYSA-J |
| XLogP | 4.88 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|