C16H15N3 — CID 23549521
5-[[(1Z)-1-(isocyanomethylidene)-3,4-dihydro-2H-naphthalen-2-yl]methyl]-1H-imidazole (PubChem CID 23549521) has the molecular formula C16H15N3 and a molecular weight of 249.32 g/mol. Its IUPAC name is 5-[[(1Z)-1-(isocyanomethylidene)-3,4-dihydro-2H-naphthalen-2-yl]methyl]-1H-imidazole.
| Compound Name | 5-[[(1Z)-1-(isocyanomethylidene)-3,4-dihydro-2H-naphthalen-2-yl]methyl]-1H-imidazole |
|---|---|
| PubChem CID | 23549521 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 5-[[(1Z)-1-(isocyanomethylidene)-3,4-dihydro-2H-naphthalen-2-yl]methyl]-1H-imidazole |
| SMILES | [C-]#[N+]/C=C1\c2ccccc2CCC1Cc1cnc[nH]1 |
| InChI | InChI=1S/C16H15N3/c1-17-10-16-13(8-14-9-18-11-19-14)7-6-12-4-2-3-5-15(12)16/h2-5,9-11,13H,6-8H2,(H,18,19)/b16-10- |
| InChIKey | SQOYUFDJCRBZGB-YBEGLDIGSA-N |
| XLogP | 3.47 |
| TPSA | 33.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|