C15H18O4 — CID 160690757
(3S,4R)-3-[(3S)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutyl]-4-methyloxetan-2-one (PubChem CID 160690757) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is (3S,4R)-3-[(3S)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutyl]-4-methyloxetan-2-one.
| Compound Name | (3S,4R)-3-[(3S)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutyl]-4-methyloxetan-2-one |
|---|---|
| PubChem CID | 160690757 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (3S,4R)-3-[(3S)-4-(4-hydroxyphenyl)-3-methyl-2-oxobutyl]-4-methyloxetan-2-one |
| SMILES | C[C@@H](Cc1ccc(O)cc1)C(=O)C[C@@H]1C(=O)O[C@@H]1C |
| InChI | InChI=1S/C15H18O4/c1-9(7-11-3-5-12(16)6-4-11)14(17)8-13-10(2)19-15(13)18/h3-6,9-10,13,16H,7-8H2,1-2H3/t9-,10+,13-/m0/s1 |
| InChIKey | RPJIYWRFEYNFOH-CWSCBRNRSA-N |
| XLogP | 2.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|