C30H35N6O11P — CID 160695732
oxetan-3-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-isocyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 160695732) has the molecular formula C30H35N6O11P and a molecular weight of 686.62 g/mol. Its IUPAC name is oxetan-3-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-isocyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | oxetan-3-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-isocyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 160695732 |
| Molecular Formula | C30H35N6O11P |
| Molecular Weight | 686.62 g/mol |
| Exact Mass | 686.21 |
| IUPAC Name | oxetan-3-yl (2S)-2-[[[(2R,3S,4S,5S)-5-(4-aminopyrrolo[2,1-f][1,2,4]triazin-7-yl)-2-isocyano-3,4-di(propanoyloxy)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | [C-]#[N+][C@]1(COP(=O)(N[C@@H](C)C(=O)OC2COC2)Oc2ccccc2)O[C@@H](c2ccc3c(N)ncnn23)[C@H](OC(=O)CC)[C@@H]1OC(=O)CC |
| InChI | InChI=1S/C30H35N6O11P/c1-5-23(37)44-26-25(21-12-13-22-28(31)33-17-34-36(21)22)46-30(32-4,27(26)45-24(38)6-2)16-42-48(40,47-19-10-8-7-9-11-19)35-18(3)29(39)43-20-14-41-15-20/h7-13,17-18,20,25-27H,5-6,14-16H2,1-3H3,(H,35,40)(H2,31,33,34)/t18-,25-,26-,27-,30+,48?/m0/s1 |
| InChIKey | RPYXYKOQOXMMEA-XPIWDRNASA-N |
| XLogP | 2.77 |
| TPSA | 205.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|