C24H37BN2O5 — CID 160696920
(3R)-2-hydroxy-3-[2-oxo-3-[4-[4-(propan-2-ylamino)butyl]piperidin-1-yl]propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid (PubChem CID 160696920) has the molecular formula C24H37BN2O5 and a molecular weight of 444.38 g/mol. Its IUPAC name is (3R)-2-hydroxy-3-[2-oxo-3-[4-[4-(propan-2-ylamino)butyl]piperidin-1-yl]propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid.
| Compound Name | (3R)-2-hydroxy-3-[2-oxo-3-[4-[4-(propan-2-ylamino)butyl]piperidin-1-yl]propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
|---|---|
| PubChem CID | 160696920 |
| Molecular Formula | C24H37BN2O5 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (3R)-2-hydroxy-3-[2-oxo-3-[4-[4-(propan-2-ylamino)butyl]piperidin-1-yl]propyl]-3,4-dihydro-1,2-benzoxaborinine-8-carboxylic acid |
| SMILES | CC(C)NCCCCC1CCN(CC(=O)C[C@H]2Cc3cccc(C(=O)O)c3OB2O)CC1 |
| InChI | InChI=1S/C24H37BN2O5/c1-17(2)26-11-4-3-6-18-9-12-27(13-10-18)16-21(28)15-20-14-19-7-5-8-22(24(29)30)23(19)32-25(20)31/h5,7-8,17-18,20,26,31H,3-4,6,9-16H2,1-2H3,(H,29,30)/t20-/m1/s1 |
| InChIKey | RQCQBHSJCIBUIJ-HXUWFJFHSA-N |
| XLogP | 3.01 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|