About 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride
4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride (PubChem CID 160702063) has the molecular formula C19H23ClN4O2
and a molecular weight of 374.87 g/mol. Its IUPAC name is 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride |
| PubChem CID | 160702063 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride |
| SMILES | Cc1ccccc1Oc1ccc(C(=O)NC(N)=NN2CCCC2)cc1.Cl |
| InChI | InChI=1S/C19H22N4O2.ClH/c1-14-6-2-3-7-17(14)25-16-10-8-15(9-11-16)18(24)21-19(20)22-23-12-4-5-13-23;/h2-3,6-11H,4-5,12-13H2,1H3,(H3,20,21,22,24);1H |
| InChIKey | RQTBIHZBNJUZFB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride?
The IUPAC name of 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride (CID 160702063) is 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride.
What is the SMILES notation for 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride?
The canonical SMILES for 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride is Cc1ccccc1Oc1ccc(C(=O)NC(N)=NN2CCCC2)cc1.Cl.
What is the InChIKey of 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride?
The InChIKey is RQTBIHZBNJUZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O2.ClH/c1-14-6-2-3-7-17(14)25-16-10-8-15(9-11-16)18(24)21-19(20)22-23-12-4-5-13-23;/h2-3,6-11H,4-5,12-13H2,1H3,(H3,20,21,22,24);1H.
What are the key properties of 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride?
4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride has a molecular weight of 374.87 g/mol, XLogP of 3.26, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenoxy)-N-(N'-pyrrolidin-1-ylcarbamimidoyl)benzamide;hydrochloride is sourced from PubChem (CID 160702063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).