C30H35N5O5 — CID 118138687
(2S)-2-amino-3-[4-[[N'-[[2-(4-methoxyphenoxy)-6-piperidin-1-ylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138687) has the molecular formula C30H35N5O5 and a molecular weight of 545.64 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(4-methoxyphenoxy)-6-piperidin-1-ylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(4-methoxyphenoxy)-6-piperidin-1-ylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138687 |
| Molecular Formula | C30H35N5O5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.26 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(4-methoxyphenoxy)-6-piperidin-1-ylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | COc1ccc(Oc2cccc(N3CCCCC3)c2C/N=C(\N)NC(=O)c2ccc(C[C@H](N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H35N5O5/c1-39-22-12-14-23(15-13-22)40-27-7-5-6-26(35-16-3-2-4-17-35)24(27)19-33-30(32)34-28(36)21-10-8-20(9-11-21)18-25(31)29(37)38/h5-15,25H,2-4,16-19,31H2,1H3,(H,37,38)(H3,32,33,34,36)/t25-/m0/s1 |
| InChIKey | VWBADURTNSPRGR-VWLOTQADSA-N |
| XLogP | 3.68 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|