C29H33N5O3 — CID 118138748
(2S)-2-amino-3-[4-[[N'-[(5-phenyl-2-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138748) has the molecular formula C29H33N5O3 and a molecular weight of 499.62 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[(5-phenyl-2-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[(5-phenyl-2-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138748 |
| Molecular Formula | C29H33N5O3 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[(5-phenyl-2-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N\Cc1cc(-c2ccccc2)ccc1N1CCCCC1)NC(=O)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C29H33N5O3/c30-25(28(36)37)17-20-9-11-22(12-10-20)27(35)33-29(31)32-19-24-18-23(21-7-3-1-4-8-21)13-14-26(24)34-15-5-2-6-16-34/h1,3-4,7-14,18,25H,2,5-6,15-17,19,30H2,(H,36,37)(H3,31,32,33,35)/t25-/m0/s1 |
| InChIKey | PJLPZLKAPWLCAH-VWLOTQADSA-N |
| XLogP | 3.54 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|