C18H18Cl2N4O3 — CID 118138580
2-amino-3-[4-[[N'-[(2,3-dichlorophenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138580) has the molecular formula C18H18Cl2N4O3 and a molecular weight of 409.27 g/mol. Its IUPAC name is 2-amino-3-[4-[[N'-[(2,3-dichlorophenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[N'-[(2,3-dichlorophenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138580 |
| Molecular Formula | C18H18Cl2N4O3 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | 2-amino-3-[4-[[N'-[(2,3-dichlorophenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N\Cc1cccc(Cl)c1Cl)NC(=O)c1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C18H18Cl2N4O3/c19-13-3-1-2-12(15(13)20)9-23-18(22)24-16(25)11-6-4-10(5-7-11)8-14(21)17(26)27/h1-7,14H,8-9,21H2,(H,26,27)(H3,22,23,24,25) |
| InChIKey | ZRHIRWKQARLXSE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 130.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|