C22H23ClN6O3 — CID 118138781
2-amino-3-[4-[[N'-[[2-chloro-6-(3-methylpyrazol-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138781) has the molecular formula C22H23ClN6O3 and a molecular weight of 454.92 g/mol. Its IUPAC name is 2-amino-3-[4-[[N'-[[2-chloro-6-(3-methylpyrazol-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[N'-[[2-chloro-6-(3-methylpyrazol-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138781 |
| Molecular Formula | C22H23ClN6O3 |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-amino-3-[4-[[N'-[[2-chloro-6-(3-methylpyrazol-1-yl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | Cc1ccn(-c2cccc(Cl)c2C/N=C(\N)NC(=O)c2ccc(CC(N)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C22H23ClN6O3/c1-13-9-10-29(28-13)19-4-2-3-17(23)16(19)12-26-22(25)27-20(30)15-7-5-14(6-8-15)11-18(24)21(31)32/h2-10,18H,11-12,24H2,1H3,(H,31,32)(H3,25,26,27,30) |
| InChIKey | GZLOMBUSMRAIOH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|