C25H33N5O3 — CID 127047046
(2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-methylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 127047046) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-methylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-methylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 127047046 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-methylphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | Cc1cccc(N2CCCCCC2)c1C/N=C(\N)NC(=O)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C25H33N5O3/c1-17-7-6-8-22(30-13-4-2-3-5-14-30)20(17)16-28-25(27)29-23(31)19-11-9-18(10-12-19)15-21(26)24(32)33/h6-12,21H,2-5,13-16,26H2,1H3,(H,32,33)(H3,27,28,29,31)/t21-/m0/s1 |
| InChIKey | YFCSQEFQCZGIEL-NRFANRHFSA-N |
| XLogP | 2.57 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|