C31H37N5O4 — CID 127047191
ethyl (2S)-2-amino-3-[4-[[N'-[(2-phenoxy-6-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoate (PubChem CID 127047191) has the molecular formula C31H37N5O4 and a molecular weight of 543.67 g/mol. Its IUPAC name is ethyl (2S)-2-amino-3-[4-[[N'-[(2-phenoxy-6-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-amino-3-[4-[[N'-[(2-phenoxy-6-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 127047191 |
| Molecular Formula | C31H37N5O4 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | ethyl (2S)-2-amino-3-[4-[[N'-[(2-phenoxy-6-piperidin-1-ylphenyl)methyl]carbamimidoyl]carbamoyl]phenyl]propanoate |
| SMILES | CCOC(=O)[C@@H](N)Cc1ccc(C(=O)N/C(N)=N/Cc2c(Oc3ccccc3)cccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C31H37N5O4/c1-2-39-30(38)26(32)20-22-14-16-23(17-15-22)29(37)35-31(33)34-21-25-27(36-18-7-4-8-19-36)12-9-13-28(25)40-24-10-5-3-6-11-24/h3,5-6,9-17,26H,2,4,7-8,18-21,32H2,1H3,(H3,33,34,35,37)/t26-/m0/s1 |
| InChIKey | NUJRVQZNDKCTFM-SANMLTNESA-N |
| XLogP | 4.15 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|