C26H33N5O5 — CID 118138756
2-amino-3-[4-[[N'-[[6-(azepan-1-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138756) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-amino-3-[4-[[N'-[[6-(azepan-1-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[[N'-[[6-(azepan-1-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138756 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-amino-3-[4-[[N'-[[6-(azepan-1-yl)-2,3-dihydro-1,4-benzodioxin-5-yl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N\Cc1c(N2CCCCCC2)ccc2c1OCCO2)NC(=O)c1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C26H33N5O5/c27-20(25(33)34)15-17-5-7-18(8-6-17)24(32)30-26(28)29-16-19-21(31-11-3-1-2-4-12-31)9-10-22-23(19)36-14-13-35-22/h5-10,20H,1-4,11-16,27H2,(H,33,34)(H3,28,29,30,32) |
| InChIKey | GMGKKZPKVZNPAE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|