C25H32ClN5O4 — CID 118138591
(2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-3-chloro-6-methoxyphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138591) has the molecular formula C25H32ClN5O4 and a molecular weight of 502.02 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-3-chloro-6-methoxyphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-3-chloro-6-methoxyphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138591 |
| Molecular Formula | C25H32ClN5O4 |
| Molecular Weight | 502.02 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-3-chloro-6-methoxyphenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | COc1ccc(Cl)c(N2CCCCCC2)c1C/N=C(\N)NC(=O)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C25H32ClN5O4/c1-35-21-11-10-19(26)22(31-12-4-2-3-5-13-31)18(21)15-29-25(28)30-23(32)17-8-6-16(7-9-17)14-20(27)24(33)34/h6-11,20H,2-5,12-15,27H2,1H3,(H,33,34)(H3,28,29,30,32)/t20-/m0/s1 |
| InChIKey | KAIXBPAUVVNVSY-FQEVSTJZSA-N |
| XLogP | 2.93 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.02 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|