C25H30F3N5O3 — CID 118138459
(2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-(trifluoromethyl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid (PubChem CID 118138459) has the molecular formula C25H30F3N5O3 and a molecular weight of 505.54 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-(trifluoromethyl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-(trifluoromethyl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 118138459 |
| Molecular Formula | C25H30F3N5O3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | (2S)-2-amino-3-[4-[[N'-[[2-(azepan-1-yl)-6-(trifluoromethyl)phenyl]methyl]carbamimidoyl]carbamoyl]phenyl]propanoic acid |
| SMILES | N/C(=N/Cc1c(N2CCCCCC2)cccc1C(F)(F)F)NC(=O)c1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C25H30F3N5O3/c26-25(27,28)19-6-5-7-21(33-12-3-1-2-4-13-33)18(19)15-31-24(30)32-22(34)17-10-8-16(9-11-17)14-20(29)23(35)36/h5-11,20H,1-4,12-15,29H2,(H,35,36)(H3,30,31,32,34)/t20-/m0/s1 |
| InChIKey | WTQIKRKLASMEET-FQEVSTJZSA-N |
| XLogP | 3.28 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|