C27H24OS2Si — CID 160709866
2-[3-[6-(2-ethynylthiophen-3-yl)-3-methoxy-7-methylnaphthalen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane (PubChem CID 160709866) has the molecular formula C27H24OS2Si and a molecular weight of 456.71 g/mol. Its IUPAC name is 2-[3-[6-(2-ethynylthiophen-3-yl)-3-methoxy-7-methylnaphthalen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3-[6-(2-ethynylthiophen-3-yl)-3-methoxy-7-methylnaphthalen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 160709866 |
| Molecular Formula | C27H24OS2Si |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 2-[3-[6-(2-ethynylthiophen-3-yl)-3-methoxy-7-methylnaphthalen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane |
| SMILES | C#Cc1sccc1-c1cc2cc(OC)c(-c3ccsc3C#C[Si](C)(C)C)cc2cc1C |
| InChI | InChI=1S/C27H24OS2Si/c1-7-26-21(8-11-29-26)23-15-20-17-25(28-3)24(16-19(20)14-18(23)2)22-9-12-30-27(22)10-13-31(4,5)6/h1,8-9,11-12,14-17H,2-6H3 |
| InChIKey | LFJGUKUHKXZZHR-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|