C35H56N2O7S — CID 160710876
5-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-5-[1-(methylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.1]heptan-2-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide (PubChem CID 160710876) has the molecular formula C35H56N2O7S and a molecular weight of 648.91 g/mol. Its IUPAC name is 5-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-5-[1-(methylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.1]heptan-2-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-5-[1-(methylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.1]heptan-2-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 160710876 |
| Molecular Formula | C35H56N2O7S |
| Molecular Weight | 648.91 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | 5-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-5-[1-(methylsulfonylmethyl)cyclohexyl]-4-oxopentanoyl]-6,6-dimethyl-3-azabicyclo[3.1.1]heptan-2-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)(C)[C@H](CC(=O)CC1(CS(C)(=O)=O)CCCCC1)C(=O)N1C[C@H]2C[C@@H]([C@H]1C(=O)CC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
| InChI | InChI=1S/C35H56N2O7S/c1-33(2,3)27(18-25(38)19-35(21-45(6,43)44)13-8-7-9-14-35)32(42)37-20-24-17-26(34(24,4)5)29(37)28(39)16-23(30(40)31(36)41)15-22-11-10-12-22/h22-24,26-27,29H,7-21H2,1-6H3,(H2,36,41)/t23?,24-,26+,27-,29+/m1/s1 |
| InChIKey | RRVNCCGHJATKCJ-SHGKRZPFSA-N |
| XLogP | 4.69 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|