C31H49NO5 — CID 58132347
(3R)-1-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)hexane-1,4,5-trione (PubChem CID 58132347) has the molecular formula C31H49NO5 and a molecular weight of 515.74 g/mol. Its IUPAC name is (3R)-1-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)hexane-1,4,5-trione.
| Compound Name | (3R)-1-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)hexane-1,4,5-trione |
|---|---|
| PubChem CID | 58132347 |
| Molecular Formula | C31H49NO5 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | (3R)-1-[(1R,2S,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]-3-(cyclobutylmethyl)hexane-1,4,5-trione |
| SMILES | CC(=O)C(=O)[C@@H](CC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](CC(=O)CC(C)(C)C)C(C)(C)C)C2(C)C)CC1CCC1 |
| InChI | InChI=1S/C31H49NO5/c1-18(33)27(36)20(13-19-11-10-12-19)14-24(35)26-25-23(31(25,8)9)17-32(26)28(37)22(30(5,6)7)15-21(34)16-29(2,3)4/h19-20,22-23,25-26H,10-17H2,1-9H3/t20-,22-,23+,25+,26-/m1/s1 |
| InChIKey | JAPILSDNRJCEFE-SATFRJSMSA-N |
| XLogP | 5.45 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|