C31H49NO5 — CID 162302749
5-[(1S,2R,3R,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide (PubChem CID 162302749) has the molecular formula C31H49NO5 and a molecular weight of 515.74 g/mol. Its IUPAC name is 5-[(1S,2R,3R,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(1S,2R,3R,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 162302749 |
| Molecular Formula | C31H49NO5 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | 5-[(1S,2R,3R,5S)-3-[(2S)-2-tert-butyl-6,6-dimethyl-4-oxoheptanoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)(C)CC(=O)C[C@H](C(=O)[C@@H]1C[C@H]2[C@@H]([C@H]1C(=O)CC(CC1CCC1)C(=O)C(N)=O)C2(C)C)C(C)(C)C |
| InChI | InChI=1S/C31H49NO5/c1-29(2,3)16-19(33)14-22(30(4,5)6)27(36)20-15-21-25(31(21,7)8)24(20)23(34)13-18(26(35)28(32)37)12-17-10-9-11-17/h17-18,20-22,24-25H,9-16H2,1-8H3,(H2,32,37)/t18?,20-,21+,22-,24-,25+/m1/s1 |
| InChIKey | NWVANLZYIRIGOP-OAAFCVLZSA-N |
| XLogP | 5.34 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|