C40H64N4O6 — CID 161396350
5-[(5R,8S)-7-[(2S,6S)-2-tert-butyl-7,7-dimethyl-4-oxo-6-(piperazine-1-carbonyl)octanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decan-8-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide (PubChem CID 161396350) has the molecular formula C40H64N4O6 and a molecular weight of 696.97 g/mol. Its IUPAC name is 5-[(5R,8S)-7-[(2S,6S)-2-tert-butyl-7,7-dimethyl-4-oxo-6-(piperazine-1-carbonyl)octanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decan-8-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide.
| Compound Name | 5-[(5R,8S)-7-[(2S,6S)-2-tert-butyl-7,7-dimethyl-4-oxo-6-(piperazine-1-carbonyl)octanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decan-8-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
|---|---|
| PubChem CID | 161396350 |
| Molecular Formula | C40H64N4O6 |
| Molecular Weight | 696.97 g/mol |
| Exact Mass | 696.48 |
| IUPAC Name | 5-[(5R,8S)-7-[(2S,6S)-2-tert-butyl-7,7-dimethyl-4-oxo-6-(piperazine-1-carbonyl)octanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decan-8-yl]-3-(cyclobutylmethyl)-2,5-dioxopentanamide |
| SMILES | CC(C)(C)[C@H](CC(=O)C[C@H](C(=O)N1C[C@]2(C[C@H]1C(=O)CC(CC1CCC1)C(=O)C(N)=O)C(C)(C)C21CCC1)C(C)(C)C)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C40H64N4O6/c1-36(2,3)28(34(49)43-17-15-42-16-18-43)21-27(45)22-29(37(4,5)6)35(50)44-24-40(38(7,8)39(40)13-10-14-39)23-30(44)31(46)20-26(32(47)33(41)48)19-25-11-9-12-25/h25-26,28-30,42H,9-24H2,1-8H3,(H2,41,48)/t26?,28-,29-,30+,40-/m1/s1 |
| InChIKey | VTQNWLLQGJNALY-KISQOMDFSA-N |
| XLogP | 4.71 |
| TPSA | 146.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.97 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|