C39H61N3O8 — CID 59630723
tert-butyl N-[4-[(3S)-3-[(5R,8S)-8-[5-amino-3-(cyclobutylmethyl)-4,5-dioxopentanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoyl]oxan-4-yl]carbamate (PubChem CID 59630723) has the molecular formula C39H61N3O8 and a molecular weight of 699.93 g/mol. Its IUPAC name is tert-butyl N-[4-[(3S)-3-[(5R,8S)-8-[5-amino-3-(cyclobutylmethyl)-4,5-dioxopentanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoyl]oxan-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(3S)-3-[(5R,8S)-8-[5-amino-3-(cyclobutylmethyl)-4,5-dioxopentanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoyl]oxan-4-yl]carbamate |
|---|---|
| PubChem CID | 59630723 |
| Molecular Formula | C39H61N3O8 |
| Molecular Weight | 699.93 g/mol |
| Exact Mass | 699.45 |
| IUPAC Name | tert-butyl N-[4-[(3S)-3-[(5R,8S)-8-[5-amino-3-(cyclobutylmethyl)-4,5-dioxopentanoyl]-10,10-dimethyl-7-azadispiro[3.0.45.14]decane-7-carbonyl]-4,4-dimethylpentanoyl]oxan-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)C[C@H](C(=O)N2C[C@]3(C[C@H]2C(=O)CC(CC2CCC2)C(=O)C(N)=O)C(C)(C)C32CCC2)C(C)(C)C)CCOCC1 |
| InChI | InChI=1S/C39H61N3O8/c1-34(2,3)26(21-29(44)37(15-17-49-18-16-37)41-33(48)50-35(4,5)6)32(47)42-23-39(36(7,8)38(39)13-10-14-38)22-27(42)28(43)20-25(30(45)31(40)46)19-24-11-9-12-24/h24-27H,9-23H2,1-8H3,(H2,40,46)(H,41,48)/t25?,26-,27+,39-/m1/s1 |
| InChIKey | ZEKLTDWSSCFHHN-BYYYKIFOSA-N |
| XLogP | 5.30 |
| TPSA | 162.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|