C37H56O4 — CID 142268412
3-but-3-enyl-1-[3-[(2R)-2-(cyclohexylmethyl)-3-[(2-methylpropan-2-yl)oxy]but-3-enoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-methylidenenon-8-ene-1,5-dione (PubChem CID 142268412) has the molecular formula C37H56O4 and a molecular weight of 564.85 g/mol. Its IUPAC name is 3-but-3-enyl-1-[3-[(2R)-2-(cyclohexylmethyl)-3-[(2-methylpropan-2-yl)oxy]but-3-enoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-methylidenenon-8-ene-1,5-dione.
| Compound Name | 3-but-3-enyl-1-[3-[(2R)-2-(cyclohexylmethyl)-3-[(2-methylpropan-2-yl)oxy]but-3-enoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-methylidenenon-8-ene-1,5-dione |
|---|---|
| PubChem CID | 142268412 |
| Molecular Formula | C37H56O4 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.42 |
| IUPAC Name | 3-but-3-enyl-1-[3-[(2R)-2-(cyclohexylmethyl)-3-[(2-methylpropan-2-yl)oxy]but-3-enoyl]-6,6-dimethyl-2-bicyclo[3.1.0]hexanyl]-4-methylidenenon-8-ene-1,5-dione |
| SMILES | C=CCCC(=O)C(=C)C(CCC=C)CC(=O)C1C(C(=O)[C@H](CC2CCCCC2)C(=C)OC(C)(C)C)CC2C1C2(C)C |
| InChI | InChI=1S/C37H56O4/c1-10-12-19-27(24(3)31(38)20-13-11-2)22-32(39)33-29(23-30-34(33)37(30,8)9)35(40)28(25(4)41-36(5,6)7)21-26-17-15-14-16-18-26/h10-11,26-30,33-34H,1-4,12-23H2,5-9H3/t27?,28-,29?,30?,33?,34?/m1/s1 |
| InChIKey | XHMDSSCGGLOEKL-HMZCHHTBSA-N |
| XLogP | 9.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|