C36H55F3O5 — CID 162598974
tert-butyl (3S)-3-cyclohexyl-4-[(1R,7R)-8,8-dimethyl-6-[4-methyl-5-oxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-3-bicyclo[5.1.0]octanyl]-4-oxobutanoate (PubChem CID 162598974) has the molecular formula C36H55F3O5 and a molecular weight of 624.83 g/mol. Its IUPAC name is tert-butyl (3S)-3-cyclohexyl-4-[(1R,7R)-8,8-dimethyl-6-[4-methyl-5-oxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-3-bicyclo[5.1.0]octanyl]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-cyclohexyl-4-[(1R,7R)-8,8-dimethyl-6-[4-methyl-5-oxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-3-bicyclo[5.1.0]octanyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 162598974 |
| Molecular Formula | C36H55F3O5 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.40 |
| IUPAC Name | tert-butyl (3S)-3-cyclohexyl-4-[(1R,7R)-8,8-dimethyl-6-[4-methyl-5-oxo-3-(2,2,2-trifluoroethyl)non-8-enoyl]-3-bicyclo[5.1.0]octanyl]-4-oxobutanoate |
| SMILES | C=CCCC(=O)C(C)C(CC(=O)C1CCC(C(=O)[C@@H](CC(=O)OC(C)(C)C)C2CCCCC2)C[C@@H]2[C@H]1C2(C)C)CC(F)(F)F |
| InChI | InChI=1S/C36H55F3O5/c1-8-9-15-29(40)22(2)25(21-36(37,38)39)19-30(41)26-17-16-24(18-28-32(26)35(28,6)7)33(43)27(23-13-11-10-12-14-23)20-31(42)44-34(3,4)5/h8,22-28,32H,1,9-21H2,2-7H3/t22?,24?,25?,26?,27-,28+,32-/m0/s1 |
| InChIKey | ZVZPMFRBMCXCNF-HXRKZMEWSA-N |
| XLogP | 8.87 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|