C24H37NO5 — CID 58262678
methyl 3-(cyclopropylmethyl)-5-[(1R,2S,5S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2,5-dioxopentanoate (PubChem CID 58262678) has the molecular formula C24H37NO5 and a molecular weight of 419.56 g/mol. Its IUPAC name is methyl 3-(cyclopropylmethyl)-5-[(1R,2S,5S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2,5-dioxopentanoate.
| Compound Name | methyl 3-(cyclopropylmethyl)-5-[(1R,2S,5S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2,5-dioxopentanoate |
|---|---|
| PubChem CID | 58262678 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | methyl 3-(cyclopropylmethyl)-5-[(1R,2S,5S)-6,6-dimethyl-3-[(2S)-2,3,3-trimethylbutanoyl]-3-azabicyclo[3.1.0]hexan-2-yl]-2,5-dioxopentanoate |
| SMILES | COC(=O)C(=O)C(CC(=O)[C@@H]1[C@@H]2[C@H](CN1C(=O)[C@@H](C)C(C)(C)C)C2(C)C)CC1CC1 |
| InChI | InChI=1S/C24H37NO5/c1-13(23(2,3)4)21(28)25-12-16-18(24(16,5)6)19(25)17(26)11-15(10-14-8-9-14)20(27)22(29)30-7/h13-16,18-19H,8-12H2,1-7H3/t13-,15?,16+,18+,19-/m1/s1 |
| InChIKey | CFCRUPYOKKHJRA-ZBOGSRDLSA-N |
| XLogP | 3.27 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|