About N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide
N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide (PubChem CID 160711401) has the molecular formula C14H18BrNO3
and a molecular weight of 328.21 g/mol. Its IUPAC name is N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide.
Molecular Properties
| Compound Name | N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide |
| PubChem CID | 160711401 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide |
| SMILES | Cc1ccc(CC(NC=O)C(C)C)cc1Br.O=C=O |
| InChI | InChI=1S/C13H18BrNO.CO2/c1-9(2)13(15-8-16)7-11-5-4-10(3)12(14)6-11;2-1-3/h4-6,8-9,13H,7H2,1-3H3,(H,15,16); |
| InChIKey | RRXFYMKUCTVZCM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide?
The IUPAC name of N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide (CID 160711401) is N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide.
What is the SMILES notation for N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide?
The canonical SMILES for N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide is Cc1ccc(CC(NC=O)C(C)C)cc1Br.O=C=O.
What is the InChIKey of N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide?
The InChIKey is RRXFYMKUCTVZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrNO.CO2/c1-9(2)13(15-8-16)7-11-5-4-10(3)12(14)6-11;2-1-3/h4-6,8-9,13H,7H2,1-3H3,(H,15,16);.
What are the key properties of N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide?
N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide has a molecular weight of 328.21 g/mol, XLogP of 2.49, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-bromo-4-methylphenyl)-3-methylbutan-2-yl]formamide;carbon dioxide is sourced from PubChem (CID 160711401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).