C26H36N4O3 — CID 160714667
N-[cyclohexyl-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]methyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide (PubChem CID 160714667) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is N-[cyclohexyl-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]methyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[cyclohexyl-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]methyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 160714667 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-[cyclohexyl-[3-[3-(dimethylamino)propylcarbamoyl]phenyl]methyl]-5-cyclopropyl-1,2-oxazole-3-carboxamide |
| SMILES | CN(C)CCCNC(=O)c1cccc(C(NC(=O)c2cc(C3CC3)on2)C2CCCCC2)c1 |
| InChI | InChI=1S/C26H36N4O3/c1-30(2)15-7-14-27-25(31)21-11-6-10-20(16-21)24(19-8-4-3-5-9-19)28-26(32)22-17-23(33-29-22)18-12-13-18/h6,10-11,16-19,24H,3-5,7-9,12-15H2,1-2H3,(H,27,31)(H,28,32) |
| InChIKey | RSHUQQZOXYHSRN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|