C22H19ClF6N6O2S — CID 160717896
1-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1,2,4-triazole;2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenesulfonyl chloride (PubChem CID 160717896) has the molecular formula C22H19ClF6N6O2S and a molecular weight of 580.94 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1,2,4-triazole;2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenesulfonyl chloride.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1,2,4-triazole;2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenesulfonyl chloride |
|---|---|
| PubChem CID | 160717896 |
| Molecular Formula | C22H19ClF6N6O2S |
| Molecular Weight | 580.94 g/mol |
| Exact Mass | 580.09 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(trifluoromethyl)-1,2,4-triazole;2,4-dimethyl-5-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]benzenesulfonyl chloride |
| SMILES | Cc1cc(C)c(S(=O)(=O)Cl)cc1-n1cnc(C(F)(F)F)n1.Cc1ccc(-n2cnc(C(F)(F)F)n2)c(C)c1 |
| InChI | InChI=1S/C11H9ClF3N3O2S.C11H10F3N3/c1-6-3-7(2)9(21(12,19)20)4-8(6)18-5-16-10(17-18)11(13,14)15;1-7-3-4-9(8(2)5-7)17-6-15-10(16-17)11(12,13)14/h3-5H,1-2H3;3-6H,1-2H3 |
| InChIKey | RSSHWTANCYWPDV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |