C13H8F9N3OS — CID 51030011
1-[2-fluoro-4-methyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]-3-(trifluoromethyl)-1,2,4-triazole (PubChem CID 51030011) has the molecular formula C13H8F9N3OS and a molecular weight of 425.28 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]-3-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-[2-fluoro-4-methyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]-3-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 51030011 |
| Molecular Formula | C13H8F9N3OS |
| Molecular Weight | 425.28 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-(2,2,3,3,3-pentafluoropropylsulfinyl)phenyl]-3-(trifluoromethyl)-1,2,4-triazole |
| SMILES | Cc1cc(F)c(-n2cnc(C(F)(F)F)n2)cc1S(=O)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F9N3OS/c1-6-2-7(14)8(25-5-23-10(24-25)12(17,18)19)3-9(6)27(26)4-11(15,16)13(20,21)22/h2-3,5H,4H2,1H3 |
| InChIKey | HPKOKUZWTMVQPC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|