C18H13F14N3O3S — CID 86644449
1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N-methyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pyrazol-5-amine (PubChem CID 86644449) has the molecular formula C18H13F14N3O3S and a molecular weight of 617.36 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N-methyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pyrazol-5-amine.
| Compound Name | 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N-methyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pyrazol-5-amine |
|---|---|
| PubChem CID | 86644449 |
| Molecular Formula | C18H13F14N3O3S |
| Molecular Weight | 617.36 g/mol |
| Exact Mass | 617.05 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N-methyl-3-[1,1,2-trifluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)ethoxy]pyrazol-5-amine |
| SMILES | CNc1cc(OC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)F)nn1-c1cc(S(=O)CC(F)(F)F)c(C)cc1F |
| InChI | InChI=1S/C18H13F14N3O3S/c1-7-3-8(19)9(4-10(7)39(36)6-14(21,22)23)35-11(33-2)5-12(34-35)37-15(24,25)13(20)38-18(31,32)16(26,27)17(28,29)30/h3-5,13,33H,6H2,1-2H3 |
| InChIKey | BBTUUPVOHQIROA-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.36 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|