C12H12F6N2OS — CID 134569805
2,2-difluoro-N-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N'-methylethanimidamide (PubChem CID 134569805) has the molecular formula C12H12F6N2OS and a molecular weight of 346.30 g/mol. Its IUPAC name is 2,2-difluoro-N-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N'-methylethanimidamide.
| Compound Name | 2,2-difluoro-N-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 134569805 |
| Molecular Formula | C12H12F6N2OS |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2,2-difluoro-N-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-N'-methylethanimidamide |
| SMILES | C/N=C(/Nc1cc(S(=O)CC(F)(F)F)c(C)cc1F)C(F)F |
| InChI | InChI=1S/C12H12F6N2OS/c1-6-3-7(13)8(20-11(19-2)10(14)15)4-9(6)22(21)5-12(16,17)18/h3-4,10H,5H2,1-2H3,(H,19,20) |
| InChIKey | KUCCCPARMQEAIA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|