C16H15F4N3OS — CID 134569588
N'-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-6-methylpyridine-3-carboximidamide (PubChem CID 134569588) has the molecular formula C16H15F4N3OS and a molecular weight of 373.38 g/mol. Its IUPAC name is N'-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-6-methylpyridine-3-carboximidamide.
| Compound Name | N'-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-6-methylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 134569588 |
| Molecular Formula | C16H15F4N3OS |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N'-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-6-methylpyridine-3-carboximidamide |
| SMILES | Cc1ccc(/C(N)=N/c2cc(S(=O)CC(F)(F)F)c(C)cc2F)cn1 |
| InChI | InChI=1S/C16H15F4N3OS/c1-9-5-12(17)13(6-14(9)25(24)8-16(18,19)20)23-15(21)11-4-3-10(2)22-7-11/h3-7H,8H2,1-2H3,(H2,21,23) |
| InChIKey | UEXJVBYNCPRSBL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|