C17H17F4N3O5S — CID 121396458
3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-5-(morpholine-4-carbonyl)imidazolidine-2,4-dione (PubChem CID 121396458) has the molecular formula C17H17F4N3O5S and a molecular weight of 451.40 g/mol. Its IUPAC name is 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-5-(morpholine-4-carbonyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-5-(morpholine-4-carbonyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121396458 |
| Molecular Formula | C17H17F4N3O5S |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | 3-[2-fluoro-4-methyl-5-(2,2,2-trifluoroethylsulfinyl)phenyl]-5-(morpholine-4-carbonyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(F)c(N2C(=O)NC(C(=O)N3CCOCC3)C2=O)cc1S(=O)CC(F)(F)F |
| InChI | InChI=1S/C17H17F4N3O5S/c1-9-6-10(18)11(7-12(9)30(28)8-17(19,20)21)24-15(26)13(22-16(24)27)14(25)23-2-4-29-5-3-23/h6-7,13H,2-5,8H2,1H3,(H,22,27) |
| InChIKey | BIQGGWGXYYRIGB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|