C15H16FN3O4 — CID 95571346
(5S)-3-(4-fluorophenyl)-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione (PubChem CID 95571346) has the molecular formula C15H16FN3O4 and a molecular weight of 321.31 g/mol. Its IUPAC name is (5S)-3-(4-fluorophenyl)-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-(4-fluorophenyl)-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95571346 |
| Molecular Formula | C15H16FN3O4 |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (5S)-3-(4-fluorophenyl)-5-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
| SMILES | O=C(C[C@@H]1NC(=O)N(c2ccc(F)cc2)C1=O)N1CCOCC1 |
| InChI | InChI=1S/C15H16FN3O4/c16-10-1-3-11(4-2-10)19-14(21)12(17-15(19)22)9-13(20)18-5-7-23-8-6-18/h1-4,12H,5-9H2,(H,17,22)/t12-/m0/s1 |
| InChIKey | SMJQOYRFCLFHLZ-LBPRGKRZSA-N |
| XLogP | 0.50 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|