C17H20FN3O4 — CID 98764941
(5S)-5-[2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-3-(4-fluorophenyl)imidazolidine-2,4-dione (PubChem CID 98764941) has the molecular formula C17H20FN3O4 and a molecular weight of 349.36 g/mol. Its IUPAC name is (5S)-5-[2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-3-(4-fluorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-3-(4-fluorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 98764941 |
| Molecular Formula | C17H20FN3O4 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (5S)-5-[2-[(2R,5S)-2,5-dimethylmorpholin-4-yl]-2-oxoethyl]-3-(4-fluorophenyl)imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)C[C@@H]2NC(=O)N(c3ccc(F)cc3)C2=O)[C@@H](C)CO1 |
| InChI | InChI=1S/C17H20FN3O4/c1-10-9-25-11(2)8-20(10)15(22)7-14-16(23)21(17(24)19-14)13-5-3-12(18)4-6-13/h3-6,10-11,14H,7-9H2,1-2H3,(H,19,24)/t10-,11+,14-/m0/s1 |
| InChIKey | SVGJADSKQKFDHM-WDMOLILDSA-N |
| XLogP | 1.28 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|