C17H20FN3O3 — CID 56814098
3-(4-fluorophenyl)-5-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 56814098) has the molecular formula C17H20FN3O3 and a molecular weight of 333.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | 3-(4-fluorophenyl)-5-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56814098 |
| Molecular Formula | C17H20FN3O3 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 3-(4-fluorophenyl)-5-[2-(3-methylpiperidin-1-yl)-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CC1CCCN(C(=O)CC2NC(=O)N(c3ccc(F)cc3)C2=O)C1 |
| InChI | InChI=1S/C17H20FN3O3/c1-11-3-2-8-20(10-11)15(22)9-14-16(23)21(17(24)19-14)13-6-4-12(18)5-7-13/h4-7,11,14H,2-3,8-10H2,1H3,(H,19,24) |
| InChIKey | BXIHZGYGLWBAEB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|