C23H23ClFN5O4 — CID 177250754
1-[(3R)-1-[3-[(4R)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoyl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 177250754) has the molecular formula C23H23ClFN5O4 and a molecular weight of 487.92 g/mol. Its IUPAC name is 1-[(3R)-1-[3-[(4R)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoyl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[(3R)-1-[3-[(4R)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoyl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 177250754 |
| Molecular Formula | C23H23ClFN5O4 |
| Molecular Weight | 487.92 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | 1-[(3R)-1-[3-[(4R)-1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoyl]pyrrolidin-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)N[C@@H]1CCN(C(=O)CC[C@H]2NC(=O)N(c3ccc(Cl)cc3)C2=O)C1 |
| InChI | InChI=1S/C23H23ClFN5O4/c24-14-1-7-18(8-2-14)30-21(32)19(28-23(30)34)9-10-20(31)29-12-11-17(13-29)27-22(33)26-16-5-3-15(25)4-6-16/h1-8,17,19H,9-13H2,(H,28,34)(H2,26,27,33)/t17-,19-/m1/s1 |
| InChIKey | HJVZTQZCLAPQRT-IEBWSBKVSA-N |
| XLogP | 3.11 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|