C20H24ClN7O3 — CID 166331717
5-[3-[3-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]-3-oxopropyl]-3-(4-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 166331717) has the molecular formula C20H24ClN7O3 and a molecular weight of 445.91 g/mol. Its IUPAC name is 5-[3-[3-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]-3-oxopropyl]-3-(4-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | 5-[3-[3-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]-3-oxopropyl]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166331717 |
| Molecular Formula | C20H24ClN7O3 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 5-[3-[3-[4-(aminomethyl)triazol-1-yl]piperidin-1-yl]-3-oxopropyl]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | NCc1cn(C2CCCN(C(=O)CCC3NC(=O)N(c4ccc(Cl)cc4)C3=O)C2)nn1 |
| InChI | InChI=1S/C20H24ClN7O3/c21-13-3-5-15(6-4-13)28-19(30)17(23-20(28)31)7-8-18(29)26-9-1-2-16(12-26)27-11-14(10-22)24-25-27/h3-6,11,16-17H,1-2,7-10,12,22H2,(H,23,31) |
| InChIKey | MUTWVHDXIVIEHK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|