C17H20Cl2N4O3 — CID 124591197
(5R)-3-(3,4-dichlorophenyl)-5-[3-[(3R)-3-methylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione (PubChem CID 124591197) has the molecular formula C17H20Cl2N4O3 and a molecular weight of 399.28 g/mol. Its IUPAC name is (5R)-3-(3,4-dichlorophenyl)-5-[3-[(3R)-3-methylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-3-(3,4-dichlorophenyl)-5-[3-[(3R)-3-methylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124591197 |
| Molecular Formula | C17H20Cl2N4O3 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | (5R)-3-(3,4-dichlorophenyl)-5-[3-[(3R)-3-methylpiperazin-1-yl]-3-oxopropyl]imidazolidine-2,4-dione |
| SMILES | C[C@@H]1CN(C(=O)CC[C@H]2NC(=O)N(c3ccc(Cl)c(Cl)c3)C2=O)CCN1 |
| InChI | InChI=1S/C17H20Cl2N4O3/c1-10-9-22(7-6-20-10)15(24)5-4-14-16(25)23(17(26)21-14)11-2-3-12(18)13(19)8-11/h2-3,8,10,14,20H,4-7,9H2,1H3,(H,21,26)/t10-,14-/m1/s1 |
| InChIKey | IXOJQYSKHCGBEX-QMTHXVAHSA-N |
| XLogP | 2.02 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|