C14H18FNO3 — CID 81207945
2-(4-fluorophenyl)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]ethanone (PubChem CID 81207945) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 81207945 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[2-(hydroxymethyl)-5-methylmorpholin-4-yl]ethanone |
| SMILES | CC1COC(CO)CN1C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FNO3/c1-10-9-19-13(8-17)7-16(10)14(18)6-11-2-4-12(15)5-3-11/h2-5,10,13,17H,6-9H2,1H3 |
| InChIKey | BVVHBURXQYSHHF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |