C12H11F7N2OS2 — CID 175407445
1-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,2,2-trifluoroethyl)thiourea (PubChem CID 175407445) has the molecular formula C12H11F7N2OS2 and a molecular weight of 396.35 g/mol. Its IUPAC name is 1-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,2,2-trifluoroethyl)thiourea.
| Compound Name | 1-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,2,2-trifluoroethyl)thiourea |
|---|---|
| PubChem CID | 175407445 |
| Molecular Formula | C12H11F7N2OS2 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-[2-fluoro-4-methyl-5-(1,2,2-trifluoroethylsulfinyl)phenyl]-3-(1,2,2-trifluoroethyl)thiourea |
| SMILES | Cc1cc(F)c(NC(=S)NC(F)C(F)F)cc1S(=O)C(F)C(F)F |
| InChI | InChI=1S/C12H11F7N2OS2/c1-4-2-5(13)6(20-12(23)21-10(18)8(14)15)3-7(4)24(22)11(19)9(16)17/h2-3,8-11H,1H3,(H2,20,21,23) |
| InChIKey | HLINYTWAURHTSQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|